C24H36N4O3 — CID 29152858
(2R)-1-(azocan-1-yl)-3-[2-methoxy-5-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol (PubChem CID 29152858) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is (2R)-1-(azocan-1-yl)-3-[2-methoxy-5-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(azocan-1-yl)-3-[2-methoxy-5-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 29152858 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (2R)-1-(azocan-1-yl)-3-[2-methoxy-5-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol |
| SMILES | COc1ccc(CNCCc2cnccn2)cc1OC[C@H](O)CN1CCCCCCC1 |
| InChI | InChI=1S/C24H36N4O3/c1-30-23-8-7-20(16-25-10-9-21-17-26-11-12-27-21)15-24(23)31-19-22(29)18-28-13-5-3-2-4-6-14-28/h7-8,11-12,15,17,22,25,29H,2-6,9-10,13-14,16,18-19H2,1H3/t22-/m1/s1 |
| InChIKey | TXNKDMJBQCFCHQ-JOCHJYFZSA-N |
| XLogP | 2.82 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|