C26H38N2O4 — CID 45226282
4-[2-[[3-[3-(azocan-1-yl)-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]phenol (PubChem CID 45226282) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 4-[2-[[3-[3-(azocan-1-yl)-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]phenol.
| Compound Name | 4-[2-[[3-[3-(azocan-1-yl)-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 45226282 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 4-[2-[[3-[3-(azocan-1-yl)-2-hydroxypropoxy]-4-methoxyphenyl]methylamino]ethyl]phenol |
| SMILES | COc1ccc(CNCCc2ccc(O)cc2)cc1OCC(O)CN1CCCCCCC1 |
| InChI | InChI=1S/C26H38N2O4/c1-31-25-12-9-22(18-27-14-13-21-7-10-23(29)11-8-21)17-26(25)32-20-24(30)19-28-15-5-3-2-4-6-16-28/h7-12,17,24,27,29-30H,2-6,13-16,18-20H2,1H3 |
| InChIKey | ILPYUEQESQHASP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|