C26H38N2O3 — CID 25369320
(2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[(3-phenylpropylamino)methyl]phenoxy]propan-2-ol (PubChem CID 25369320) has the molecular formula C26H38N2O3 and a molecular weight of 426.60 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[(3-phenylpropylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[(3-phenylpropylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25369320 |
| Molecular Formula | C26H38N2O3 |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[(3-phenylpropylamino)methyl]phenoxy]propan-2-ol |
| SMILES | COc1cc(CNCCCc2ccccc2)ccc1OC[C@H](O)CN1CCCCCC1 |
| InChI | InChI=1S/C26H38N2O3/c1-30-26-18-23(19-27-15-9-12-22-10-5-4-6-11-22)13-14-25(26)31-21-24(29)20-28-16-7-2-3-8-17-28/h4-6,10-11,13-14,18,24,27,29H,2-3,7-9,12,15-17,19-21H2,1H3/t24-/m1/s1 |
| InChIKey | GPKRNZKWXSMVLT-XMMPIXPASA-N |
| XLogP | 4.03 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|