C24H34N2O3 — CID 26390841
(2R)-1-[2-methoxy-4-[[2-(2-methylphenyl)ethylamino]methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 26390841) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is (2R)-1-[2-methoxy-4-[[2-(2-methylphenyl)ethylamino]methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[2-methoxy-4-[[2-(2-methylphenyl)ethylamino]methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 26390841 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (2R)-1-[2-methoxy-4-[[2-(2-methylphenyl)ethylamino]methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | COc1cc(CNCCc2ccccc2C)ccc1OC[C@H](O)CN1CCCC1 |
| InChI | InChI=1S/C24H34N2O3/c1-19-7-3-4-8-21(19)11-12-25-16-20-9-10-23(24(15-20)28-2)29-18-22(27)17-26-13-5-6-14-26/h3-4,7-10,15,22,25,27H,5-6,11-14,16-18H2,1-2H3/t22-/m1/s1 |
| InChIKey | YMHRQXCUQFQOJL-JOCHJYFZSA-N |
| XLogP | 3.17 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|