C20H34N2O4 — CID 26401319
(2R)-1-[2-methoxy-4-[(2-propan-2-yloxyethylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 26401319) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is (2R)-1-[2-methoxy-4-[(2-propan-2-yloxyethylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | (2R)-1-[2-methoxy-4-[(2-propan-2-yloxyethylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 26401319 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | (2R)-1-[2-methoxy-4-[(2-propan-2-yloxyethylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | COc1cc(CNCCOC(C)C)ccc1OC[C@H](O)CN1CCCC1 |
| InChI | InChI=1S/C20H34N2O4/c1-16(2)25-11-8-21-13-17-6-7-19(20(12-17)24-3)26-15-18(23)14-22-9-4-5-10-22/h6-7,12,16,18,21,23H,4-5,8-11,13-15H2,1-3H3/t18-/m1/s1 |
| InChIKey | SZUOUQPEESZFGD-GOSISDBHSA-N |
| XLogP | 2.05 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|