C23H33N3O3 — CID 45210392
1-[2-methoxy-5-[(3-pyridin-3-ylpropylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 45210392) has the molecular formula C23H33N3O3 and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-[2-methoxy-5-[(3-pyridin-3-ylpropylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | 1-[2-methoxy-5-[(3-pyridin-3-ylpropylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 45210392 |
| Molecular Formula | C23H33N3O3 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | 1-[2-methoxy-5-[(3-pyridin-3-ylpropylamino)methyl]phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | COc1ccc(CNCCCc2cccnc2)cc1OCC(O)CN1CCCC1 |
| InChI | InChI=1S/C23H33N3O3/c1-28-22-9-8-20(16-25-11-5-7-19-6-4-10-24-15-19)14-23(22)29-18-21(27)17-26-12-2-3-13-26/h4,6,8-10,14-15,21,25,27H,2-3,5,7,11-13,16-18H2,1H3 |
| InChIKey | YMLNCVYLNUTRNC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|