C26H38N2O4 — CID 45242332
1-(azocan-1-yl)-3-[2-methoxy-5-[[(3-methoxyphenyl)methylamino]methyl]phenoxy]propan-2-ol (PubChem CID 45242332) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-(azocan-1-yl)-3-[2-methoxy-5-[[(3-methoxyphenyl)methylamino]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(azocan-1-yl)-3-[2-methoxy-5-[[(3-methoxyphenyl)methylamino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45242332 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-(azocan-1-yl)-3-[2-methoxy-5-[[(3-methoxyphenyl)methylamino]methyl]phenoxy]propan-2-ol |
| SMILES | COc1cccc(CNCc2ccc(OC)c(OCC(O)CN3CCCCCCC3)c2)c1 |
| InChI | InChI=1S/C26H38N2O4/c1-30-24-10-8-9-21(15-24)17-27-18-22-11-12-25(31-2)26(16-22)32-20-23(29)19-28-13-6-4-3-5-7-14-28/h8-12,15-16,23,27,29H,3-7,13-14,17-20H2,1-2H3 |
| InChIKey | UFEPQAILEPGCSD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |