C25H35FN2O3 — CID 45223808
1-(azocan-1-yl)-3-[5-[[(3-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol (PubChem CID 45223808) has the molecular formula C25H35FN2O3 and a molecular weight of 430.56 g/mol. Its IUPAC name is 1-(azocan-1-yl)-3-[5-[[(3-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol.
| Compound Name | 1-(azocan-1-yl)-3-[5-[[(3-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45223808 |
| Molecular Formula | C25H35FN2O3 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 1-(azocan-1-yl)-3-[5-[[(3-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
| SMILES | COc1ccc(CNCc2cccc(F)c2)cc1OCC(O)CN1CCCCCCC1 |
| InChI | InChI=1S/C25H35FN2O3/c1-30-24-11-10-21(17-27-16-20-8-7-9-22(26)14-20)15-25(24)31-19-23(29)18-28-12-5-3-2-4-6-13-28/h7-11,14-15,23,27,29H,2-6,12-13,16-19H2,1H3 |
| InChIKey | OXWNKXIGRPBBSD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |