C25H36FN3O3 — CID 45222649
1-(4-ethylpiperazin-1-yl)-3-[4-[[2-(3-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol (PubChem CID 45222649) has the molecular formula C25H36FN3O3 and a molecular weight of 445.58 g/mol. Its IUPAC name is 1-(4-ethylpiperazin-1-yl)-3-[4-[[2-(3-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol.
| Compound Name | 1-(4-ethylpiperazin-1-yl)-3-[4-[[2-(3-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45222649 |
| Molecular Formula | C25H36FN3O3 |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-(4-ethylpiperazin-1-yl)-3-[4-[[2-(3-fluorophenyl)ethylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
| SMILES | CCN1CCN(CC(O)COc2ccc(CNCCc3cccc(F)c3)cc2OC)CC1 |
| InChI | InChI=1S/C25H36FN3O3/c1-3-28-11-13-29(14-12-28)18-23(30)19-32-24-8-7-21(16-25(24)31-2)17-27-10-9-20-5-4-6-22(26)15-20/h4-8,15-16,23,27,30H,3,9-14,17-19H2,1-2H3 |
| InChIKey | SYHOMYXMXPXXEA-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|