C24H34ClN3O3 — CID 45243275
1-[5-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol (PubChem CID 45243275) has the molecular formula C24H34ClN3O3 and a molecular weight of 448.01 g/mol. Its IUPAC name is 1-[5-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-[5-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 45243275 |
| Molecular Formula | C24H34ClN3O3 |
| Molecular Weight | 448.01 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-[5-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-(4-methylpiperazin-1-yl)propan-2-ol |
| SMILES | COc1ccc(CNCCc2cccc(Cl)c2)cc1OCC(O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C24H34ClN3O3/c1-27-10-12-28(13-11-27)17-22(29)18-31-24-15-20(6-7-23(24)30-2)16-26-9-8-19-4-3-5-21(25)14-19/h3-7,14-15,22,26,29H,8-13,16-18H2,1-2H3 |
| InChIKey | KYICKYOTQGWMLK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.01 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|