C23H33ClN2O3 — CID 45230970
1-[4-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol (PubChem CID 45230970) has the molecular formula C23H33ClN2O3 and a molecular weight of 420.98 g/mol. Its IUPAC name is 1-[4-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol.
| Compound Name | 1-[4-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 45230970 |
| Molecular Formula | C23H33ClN2O3 |
| Molecular Weight | 420.98 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1-[4-[[2-(3-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
| SMILES | COc1cc(CNCCc2cccc(Cl)c2)ccc1OCC(O)CN(C)C(C)C |
| InChI | InChI=1S/C23H33ClN2O3/c1-17(2)26(3)15-21(27)16-29-22-9-8-19(13-23(22)28-4)14-25-11-10-18-6-5-7-20(24)12-18/h5-9,12-13,17,21,25,27H,10-11,14-16H2,1-4H3 |
| InChIKey | PNQUSCBWNRLACX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.98 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|