C20H31N3O3S — CID 45198212
1-[2-methoxy-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol (PubChem CID 45198212) has the molecular formula C20H31N3O3S and a molecular weight of 393.55 g/mol. Its IUPAC name is 1-[2-methoxy-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol.
| Compound Name | 1-[2-methoxy-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 45198212 |
| Molecular Formula | C20H31N3O3S |
| Molecular Weight | 393.55 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 1-[2-methoxy-5-[[2-(1,3-thiazol-4-yl)ethylamino]methyl]phenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
| SMILES | COc1ccc(CNCCc2cscn2)cc1OCC(O)CN(C)C(C)C |
| InChI | InChI=1S/C20H31N3O3S/c1-15(2)23(3)11-18(24)12-26-20-9-16(5-6-19(20)25-4)10-21-8-7-17-13-27-14-22-17/h5-6,9,13-15,18,21,24H,7-8,10-12H2,1-4H3 |
| InChIKey | BYFTUWPHQAUFDH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.55 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|