C19H34N2O3 — CID 25382567
(2S)-1-[4-(butylaminomethyl)-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol (PubChem CID 25382567) has the molecular formula C19H34N2O3 and a molecular weight of 338.49 g/mol. Its IUPAC name is (2S)-1-[4-(butylaminomethyl)-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol.
| Compound Name | (2S)-1-[4-(butylaminomethyl)-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 25382567 |
| Molecular Formula | C19H34N2O3 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | (2S)-1-[4-(butylaminomethyl)-2-methoxyphenoxy]-3-[methyl(propan-2-yl)amino]propan-2-ol |
| SMILES | CCCCNCc1ccc(OC[C@@H](O)CN(C)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C19H34N2O3/c1-6-7-10-20-12-16-8-9-18(19(11-16)23-5)24-14-17(22)13-21(4)15(2)3/h8-9,11,15,17,20,22H,6-7,10,12-14H2,1-5H3/t17-/m0/s1 |
| InChIKey | ZYSXTOLCVMNHMV-KRWDZBQOSA-N |
| XLogP | 2.66 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|