C19H34N2O4 — CID 45238338
1-(diethylamino)-3-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]propan-2-ol (PubChem CID 45238338) has the molecular formula C19H34N2O4 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-(diethylamino)-3-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(diethylamino)-3-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45238338 |
| Molecular Formula | C19H34N2O4 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.25 |
| IUPAC Name | 1-(diethylamino)-3-[2-methoxy-4-[(3-methoxypropylamino)methyl]phenoxy]propan-2-ol |
| SMILES | CCN(CC)CC(O)COc1ccc(CNCCCOC)cc1OC |
| InChI | InChI=1S/C19H34N2O4/c1-5-21(6-2)14-17(22)15-25-18-9-8-16(12-19(18)24-4)13-20-10-7-11-23-3/h8-9,12,17,20,22H,5-7,10-11,13-15H2,1-4H3 |
| InChIKey | IXWPBTSAMWRLRG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|