C18H32N2O3 — CID 25482880
(2S)-1-(diethylamino)-3-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]propan-2-ol (PubChem CID 25482880) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is (2S)-1-(diethylamino)-3-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(diethylamino)-3-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25482880 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | (2S)-1-(diethylamino)-3-[2-methoxy-4-[(propan-2-ylamino)methyl]phenoxy]propan-2-ol |
| SMILES | CCN(CC)C[C@H](O)COc1ccc(CNC(C)C)cc1OC |
| InChI | InChI=1S/C18H32N2O3/c1-6-20(7-2)12-16(21)13-23-17-9-8-15(10-18(17)22-5)11-19-14(3)4/h8-10,14,16,19,21H,6-7,11-13H2,1-5H3/t16-/m0/s1 |
| InChIKey | HFTWZDAOMPWARN-INIZCTEOSA-N |
| XLogP | 2.27 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |