C22H31FN2O3 — CID 45177902
1-(diethylamino)-3-[4-[[(2-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol (PubChem CID 45177902) has the molecular formula C22H31FN2O3 and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-(diethylamino)-3-[4-[[(2-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol.
| Compound Name | 1-(diethylamino)-3-[4-[[(2-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45177902 |
| Molecular Formula | C22H31FN2O3 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | 1-(diethylamino)-3-[4-[[(2-fluorophenyl)methylamino]methyl]-2-methoxyphenoxy]propan-2-ol |
| SMILES | CCN(CC)CC(O)COc1ccc(CNCc2ccccc2F)cc1OC |
| InChI | InChI=1S/C22H31FN2O3/c1-4-25(5-2)15-19(26)16-28-21-11-10-17(12-22(21)27-3)13-24-14-18-8-6-7-9-20(18)23/h6-12,19,24,26H,4-5,13-16H2,1-3H3 |
| InChIKey | OHELTUDQSDVDFG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |