C21H32N4O3 — CID 26319779
(2R)-1-(diethylamino)-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol (PubChem CID 26319779) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is (2R)-1-(diethylamino)-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(diethylamino)-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 26319779 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (2R)-1-(diethylamino)-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol |
| SMILES | CCN(CC)C[C@@H](O)COc1ccc(CNCCc2cnccn2)cc1OC |
| InChI | InChI=1S/C21H32N4O3/c1-4-25(5-2)15-19(26)16-28-20-7-6-17(12-21(20)27-3)13-22-9-8-18-14-23-10-11-24-18/h6-7,10-12,14,19,22,26H,4-5,8-9,13,15-16H2,1-3H3/t19-/m1/s1 |
| InChIKey | JCXOTPUHYVBXAR-LJQANCHMSA-N |
| XLogP | 1.90 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|