C24H36N4O3 — CID 45203324
1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol (PubChem CID 45203324) has the molecular formula C24H36N4O3 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45203324 |
| Molecular Formula | C24H36N4O3 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-[(2-pyrazin-2-ylethylamino)methyl]phenoxy]propan-2-ol |
| SMILES | COc1cc(CNCCc2cnccn2)ccc1OCC(O)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C24H36N4O3/c1-28(21-6-4-3-5-7-21)17-22(29)18-31-23-9-8-19(14-24(23)30-2)15-25-11-10-20-16-26-12-13-27-20/h8-9,12-14,16,21-22,25,29H,3-7,10-11,15,17-18H2,1-2H3 |
| InChIKey | CTFCVCCVGKRRCW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|