C26H42N2O4 — CID 42566976
4-[[[4-[(2S)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]-3-methoxyphenyl]methylamino]methyl]hepta-1,6-dien-4-ol (PubChem CID 42566976) has the molecular formula C26H42N2O4 and a molecular weight of 446.63 g/mol. Its IUPAC name is 4-[[[4-[(2S)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]-3-methoxyphenyl]methylamino]methyl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[[[4-[(2S)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]-3-methoxyphenyl]methylamino]methyl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 42566976 |
| Molecular Formula | C26H42N2O4 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.31 |
| IUPAC Name | 4-[[[4-[(2S)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]-3-methoxyphenyl]methylamino]methyl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)CNCc1ccc(OC[C@@H](O)CN(C)C2CCCCC2)c(OC)c1 |
| InChI | InChI=1S/C26H42N2O4/c1-5-14-26(30,15-6-2)20-27-17-21-12-13-24(25(16-21)31-4)32-19-23(29)18-28(3)22-10-8-7-9-11-22/h5-6,12-13,16,22-23,27,29-30H,1-2,7-11,14-15,17-20H2,3-4H3/t23-/m0/s1 |
| InChIKey | OXNAQDOJOZDSST-QHCPKHFHSA-N |
| XLogP | 3.67 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|