C23H38N2O3 — CID 97279782
(2S)-1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-(piperidin-1-ylmethyl)phenoxy]propan-2-ol (PubChem CID 97279782) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is (2S)-1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-(piperidin-1-ylmethyl)phenoxy]propan-2-ol.
| Compound Name | (2S)-1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-(piperidin-1-ylmethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 97279782 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (2S)-1-[cyclohexyl(methyl)amino]-3-[2-methoxy-4-(piperidin-1-ylmethyl)phenoxy]propan-2-ol |
| SMILES | COc1cc(CN2CCCCC2)ccc1OC[C@@H](O)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C23H38N2O3/c1-24(20-9-5-3-6-10-20)17-21(26)18-28-22-12-11-19(15-23(22)27-2)16-25-13-7-4-8-14-25/h11-12,15,20-21,26H,3-10,13-14,16-18H2,1-2H3/t21-/m0/s1 |
| InChIKey | HXWJMKPVJODLFG-NRFANRHFSA-N |
| XLogP | 3.69 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |