C25H40N2O3 — CID 42355676
4-[[[2-[(2R)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]phenyl]methylamino]methyl]hepta-1,6-dien-4-ol (PubChem CID 42355676) has the molecular formula C25H40N2O3 and a molecular weight of 416.61 g/mol. Its IUPAC name is 4-[[[2-[(2R)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]phenyl]methylamino]methyl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[[[2-[(2R)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]phenyl]methylamino]methyl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 42355676 |
| Molecular Formula | C25H40N2O3 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | 4-[[[2-[(2R)-3-[cyclohexyl(methyl)amino]-2-hydroxypropoxy]phenyl]methylamino]methyl]hepta-1,6-dien-4-ol |
| SMILES | C=CCC(O)(CC=C)CNCc1ccccc1OC[C@H](O)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C25H40N2O3/c1-4-15-25(29,16-5-2)20-26-17-21-11-9-10-14-24(21)30-19-23(28)18-27(3)22-12-7-6-8-13-22/h4-5,9-11,14,22-23,26,28-29H,1-2,6-8,12-13,15-20H2,3H3/t23-/m1/s1 |
| InChIKey | KSTNGLZDSDDAAK-HSZRJFAPSA-N |
| XLogP | 3.66 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|