C24H38N4O2 — CID 45221908
1-[cyclohexyl(methyl)amino]-3-[2-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol (PubChem CID 45221908) has the molecular formula C24H38N4O2 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-[cyclohexyl(methyl)amino]-3-[2-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[cyclohexyl(methyl)amino]-3-[2-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45221908 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | 1-[cyclohexyl(methyl)amino]-3-[2-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethylamino]methyl]phenoxy]propan-2-ol |
| SMILES | Cc1n[nH]c(C)c1CCNCc1ccccc1OCC(O)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C24H38N4O2/c1-18-23(19(2)27-26-18)13-14-25-15-20-9-7-8-12-24(20)30-17-22(29)16-28(3)21-10-5-4-6-11-21/h7-9,12,21-22,25,29H,4-6,10-11,13-17H2,1-3H3,(H,26,27) |
| InChIKey | XBXPBXMKECDDQO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 73.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|