C23H38N2O2 — CID 45200049
1-[cyclohexyl(methyl)amino]-3-[2-[(4-methylpiperidin-1-yl)methyl]phenoxy]propan-2-ol (PubChem CID 45200049) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-[cyclohexyl(methyl)amino]-3-[2-[(4-methylpiperidin-1-yl)methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[cyclohexyl(methyl)amino]-3-[2-[(4-methylpiperidin-1-yl)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45200049 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | 1-[cyclohexyl(methyl)amino]-3-[2-[(4-methylpiperidin-1-yl)methyl]phenoxy]propan-2-ol |
| SMILES | CC1CCN(Cc2ccccc2OCC(O)CN(C)C2CCCCC2)CC1 |
| InChI | InChI=1S/C23H38N2O2/c1-19-12-14-25(15-13-19)16-20-8-6-7-11-23(20)27-18-22(26)17-24(2)21-9-4-3-5-10-21/h6-8,11,19,21-22,26H,3-5,9-10,12-18H2,1-2H3 |
| InChIKey | JZGFGVRRPFBGEQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |