C16H24ClFNO2- — CID 53350472
1-[cyclohexyl(methyl)amino]-3-(2-fluorophenoxy)propan-2-ol chloride (PubChem CID 53350472) has the molecular formula C16H24ClFNO2- and a molecular weight of 316.82 g/mol. Its IUPAC name is 1-[cyclohexyl(methyl)amino]-3-(2-fluorophenoxy)propan-2-ol chloride.
| Compound Name | 1-[cyclohexyl(methyl)amino]-3-(2-fluorophenoxy)propan-2-ol chloride |
|---|---|
| PubChem CID | 53350472 |
| Molecular Formula | C16H24ClFNO2- |
| Molecular Weight | 316.82 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-[cyclohexyl(methyl)amino]-3-(2-fluorophenoxy)propan-2-ol chloride |
| SMILES | CN(CC(O)COc1ccccc1F)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C16H24FNO2.ClH/c1-18(13-7-3-2-4-8-13)11-14(19)12-20-16-10-6-5-9-15(16)17;/h5-6,9-10,13-14,19H,2-4,7-8,11-12H2,1H3;1H/p-1 |
| InChIKey | GSBHLBHUKTXVCA-UHFFFAOYSA-M |
| XLogP | -0.17 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.82 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |