C23H34N2O2 — CID 42362650
(2S)-1-[cyclohexyl(methyl)amino]-3-[2-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol (PubChem CID 42362650) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is (2S)-1-[cyclohexyl(methyl)amino]-3-[2-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-[cyclohexyl(methyl)amino]-3-[2-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 42362650 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | (2S)-1-[cyclohexyl(methyl)amino]-3-[2-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol |
| SMILES | C#CCN(CC=C)Cc1ccccc1OC[C@@H](O)CN(C)C1CCCCC1 |
| InChI | InChI=1S/C23H34N2O2/c1-4-15-25(16-5-2)17-20-11-9-10-14-23(20)27-19-22(26)18-24(3)21-12-7-6-8-13-21/h1,5,9-11,14,21-22,26H,2,6-8,12-13,15-19H2,3H3/t22-/m0/s1 |
| InChIKey | SWXZIZOVZZEPQD-QFIPXVFZSA-N |
| XLogP | 3.31 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|