C24H36N2O3 — CID 45188895
1-(azocan-1-yl)-3-[2-methoxy-4-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol (PubChem CID 45188895) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is 1-(azocan-1-yl)-3-[2-methoxy-4-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(azocan-1-yl)-3-[2-methoxy-4-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45188895 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | 1-(azocan-1-yl)-3-[2-methoxy-4-[[prop-2-enyl(prop-2-ynyl)amino]methyl]phenoxy]propan-2-ol |
| SMILES | C#CCN(CC=C)Cc1ccc(OCC(O)CN2CCCCCCC2)c(OC)c1 |
| InChI | InChI=1S/C24H36N2O3/c1-4-13-25(14-5-2)18-21-11-12-23(24(17-21)28-3)29-20-22(27)19-26-15-9-7-6-8-10-16-26/h1,5,11-12,17,22,27H,2,6-10,13-16,18-20H2,3H3 |
| InChIKey | NIOWCSISURHIAX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|