C20H34N2O4 — CID 72915580
1-(azepan-1-yl)-3-[4-[[2-hydroxyethyl(methyl)amino]methyl]-2-methoxyphenoxy]propan-2-ol (PubChem CID 72915580) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[4-[[2-hydroxyethyl(methyl)amino]methyl]-2-methoxyphenoxy]propan-2-ol.
| Compound Name | 1-(azepan-1-yl)-3-[4-[[2-hydroxyethyl(methyl)amino]methyl]-2-methoxyphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 72915580 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 1-(azepan-1-yl)-3-[4-[[2-hydroxyethyl(methyl)amino]methyl]-2-methoxyphenoxy]propan-2-ol |
| SMILES | COc1cc(CN(C)CCO)ccc1OCC(O)CN1CCCCCC1 |
| InChI | InChI=1S/C20H34N2O4/c1-21(11-12-23)14-17-7-8-19(20(13-17)25-2)26-16-18(24)15-22-9-5-3-4-6-10-22/h7-8,13,18,23-24H,3-6,9-12,14-16H2,1-2H3 |
| InChIKey | YOHCLGOWDREJMZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |