C21H34N2O3 — CID 97273699
(2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[[methyl(prop-2-enyl)amino]methyl]phenoxy]propan-2-ol (PubChem CID 97273699) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[[methyl(prop-2-enyl)amino]methyl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[[methyl(prop-2-enyl)amino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 97273699 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-3-[2-methoxy-4-[[methyl(prop-2-enyl)amino]methyl]phenoxy]propan-2-ol |
| SMILES | C=CCN(C)Cc1ccc(OC[C@H](O)CN2CCCCCC2)c(OC)c1 |
| InChI | InChI=1S/C21H34N2O3/c1-4-11-22(2)15-18-9-10-20(21(14-18)25-3)26-17-19(24)16-23-12-7-5-6-8-13-23/h4,9-10,14,19,24H,1,5-8,11-13,15-17H2,2-3H3/t19-/m1/s1 |
| InChIKey | HMRKERYWQXIOMA-LJQANCHMSA-N |
| XLogP | 2.93 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|