C23H39N3O3 — CID 30673704
(2R)-1-[4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol (PubChem CID 30673704) has the molecular formula C23H39N3O3 and a molecular weight of 405.58 g/mol. Its IUPAC name is (2R)-1-[4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 30673704 |
| Molecular Formula | C23H39N3O3 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.30 |
| IUPAC Name | (2R)-1-[4-[[ethyl(2-methylprop-2-enyl)amino]methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol |
| SMILES | C=C(C)CN(CC)Cc1ccc(OC[C@H](O)CN2CCN(CC)CC2)c(OC)c1 |
| InChI | InChI=1S/C23H39N3O3/c1-6-24-10-12-26(13-11-24)17-21(27)18-29-22-9-8-20(14-23(22)28-5)16-25(7-2)15-19(3)4/h8-9,14,21,27H,3,6-7,10-13,15-18H2,1-2,4-5H3/t21-/m1/s1 |
| InChIKey | CIRFEPWRPJULKD-OAQYLSRUSA-N |
| XLogP | 2.47 |
| TPSA | 48.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|