C24H41N3O3 — CID 45239803
1-[4-[(cycloheptylamino)methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol (PubChem CID 45239803) has the molecular formula C24H41N3O3 and a molecular weight of 419.61 g/mol. Its IUPAC name is 1-[4-[(cycloheptylamino)methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol.
| Compound Name | 1-[4-[(cycloheptylamino)methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 45239803 |
| Molecular Formula | C24H41N3O3 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.31 |
| IUPAC Name | 1-[4-[(cycloheptylamino)methyl]-2-methoxyphenoxy]-3-(4-ethylpiperazin-1-yl)propan-2-ol |
| SMILES | CCN1CCN(CC(O)COc2ccc(CNC3CCCCCC3)cc2OC)CC1 |
| InChI | InChI=1S/C24H41N3O3/c1-3-26-12-14-27(15-13-26)18-22(28)19-30-23-11-10-20(16-24(23)29-2)17-25-21-8-6-4-5-7-9-21/h10-11,16,21-22,25,28H,3-9,12-15,17-19H2,1-2H3 |
| InChIKey | KZQOSMZXNOIAGR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |