C26H45N3O3 — CID 45247292
1-(azocan-1-yl)-3-[2-methoxy-5-[[(1-propylpiperidin-4-yl)amino]methyl]phenoxy]propan-2-ol (PubChem CID 45247292) has the molecular formula C26H45N3O3 and a molecular weight of 447.66 g/mol. Its IUPAC name is 1-(azocan-1-yl)-3-[2-methoxy-5-[[(1-propylpiperidin-4-yl)amino]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(azocan-1-yl)-3-[2-methoxy-5-[[(1-propylpiperidin-4-yl)amino]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 45247292 |
| Molecular Formula | C26H45N3O3 |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.35 |
| IUPAC Name | 1-(azocan-1-yl)-3-[2-methoxy-5-[[(1-propylpiperidin-4-yl)amino]methyl]phenoxy]propan-2-ol |
| SMILES | CCCN1CCC(NCc2ccc(OC)c(OCC(O)CN3CCCCCCC3)c2)CC1 |
| InChI | InChI=1S/C26H45N3O3/c1-3-13-28-16-11-23(12-17-28)27-19-22-9-10-25(31-2)26(18-22)32-21-24(30)20-29-14-7-5-4-6-8-15-29/h9-10,18,23-24,27,30H,3-8,11-17,19-21H2,1-2H3 |
| InChIKey | YTYVZMPWRRGCES-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |