C21H34N2O3S — CID 25297739
(2R)-1-[4-[(cyclohexylamino)methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 25297739) has the molecular formula C21H34N2O3S and a molecular weight of 394.58 g/mol. Its IUPAC name is (2R)-1-[4-[(cyclohexylamino)methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[4-[(cyclohexylamino)methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 25297739 |
| Molecular Formula | C21H34N2O3S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (2R)-1-[4-[(cyclohexylamino)methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | COc1cc(CNC2CCCCC2)ccc1OC[C@H](O)CN1CCSCC1 |
| InChI | InChI=1S/C21H34N2O3S/c1-25-21-13-17(14-22-18-5-3-2-4-6-18)7-8-20(21)26-16-19(24)15-23-9-11-27-12-10-23/h7-8,13,18-19,22,24H,2-6,9-12,14-16H2,1H3/t19-/m1/s1 |
| InChIKey | GRGSXZODDOLPME-LJQANCHMSA-N |
| XLogP | 2.91 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |