C19H33N3O3S — CID 29216360
(2R)-1-[4-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol (PubChem CID 29216360) has the molecular formula C19H33N3O3S and a molecular weight of 383.56 g/mol. Its IUPAC name is (2R)-1-[4-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[4-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 29216360 |
| Molecular Formula | C19H33N3O3S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (2R)-1-[4-[[2-(dimethylamino)ethylamino]methyl]-2-methoxyphenoxy]-3-thiomorpholin-4-ylpropan-2-ol |
| SMILES | COc1cc(CNCCN(C)C)ccc1OC[C@H](O)CN1CCSCC1 |
| InChI | InChI=1S/C19H33N3O3S/c1-21(2)7-6-20-13-16-4-5-18(19(12-16)24-3)25-15-17(23)14-22-8-10-26-11-9-22/h4-5,12,17,20,23H,6-11,13-15H2,1-3H3/t17-/m1/s1 |
| InChIKey | HTCRMCQLVYBMSO-QGZVFWFLSA-N |
| XLogP | 1.13 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|