C22H36N2O4 — CID 28872431
(2R)-1-[4-[(cyclohexylmethylamino)methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 28872431) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is (2R)-1-[4-[(cyclohexylmethylamino)methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[4-[(cyclohexylmethylamino)methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 28872431 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | (2R)-1-[4-[(cyclohexylmethylamino)methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1cc(CNCC2CCCCC2)ccc1OC[C@H](O)CN1CCOCC1 |
| InChI | InChI=1S/C22H36N2O4/c1-26-22-13-19(15-23-14-18-5-3-2-4-6-18)7-8-21(22)28-17-20(25)16-24-9-11-27-12-10-24/h7-8,13,18,20,23,25H,2-6,9-12,14-17H2,1H3/t20-/m1/s1 |
| InChIKey | VYNXMYWYWQAHNQ-HXUWFJFHSA-N |
| XLogP | 2.44 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |