C23H32N2O5 — CID 29027193
(2S)-1-[2-methoxy-4-[(2-phenoxyethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 29027193) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is (2S)-1-[2-methoxy-4-[(2-phenoxyethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2S)-1-[2-methoxy-4-[(2-phenoxyethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 29027193 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (2S)-1-[2-methoxy-4-[(2-phenoxyethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1cc(CNCCOc2ccccc2)ccc1OC[C@@H](O)CN1CCOCC1 |
| InChI | InChI=1S/C23H32N2O5/c1-27-23-15-19(16-24-9-12-29-21-5-3-2-4-6-21)7-8-22(23)30-18-20(26)17-25-10-13-28-14-11-25/h2-8,15,20,24,26H,9-14,16-18H2,1H3/t20-/m0/s1 |
| InChIKey | VBMYEWAETJRGPP-FQEVSTJZSA-N |
| XLogP | 1.94 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|