C23H33N3O5 — CID 42519703
1-[(2R)-2-hydroxy-3-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol (PubChem CID 42519703) has the molecular formula C23H33N3O5 and a molecular weight of 431.53 g/mol. Its IUPAC name is 1-[(2R)-2-hydroxy-3-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[(2R)-2-hydroxy-3-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 42519703 |
| Molecular Formula | C23H33N3O5 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 1-[(2R)-2-hydroxy-3-[2-methoxy-4-[(2-pyridin-3-yloxyethylamino)methyl]phenoxy]propyl]piperidin-4-ol |
| SMILES | COc1cc(CNCCOc2cccnc2)ccc1OC[C@H](O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C23H33N3O5/c1-29-23-13-18(14-25-9-12-30-21-3-2-8-24-15-21)4-5-22(23)31-17-20(28)16-26-10-6-19(27)7-11-26/h2-5,8,13,15,19-20,25,27-28H,6-7,9-12,14,16-17H2,1H3/t20-/m1/s1 |
| InChIKey | YLXZGJUPOCJOQU-HXUWFJFHSA-N |
| XLogP | 1.46 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|