C24H38N4O4 — CID 45203135
1-[3-[4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol (PubChem CID 45203135) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-[3-[4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol.
| Compound Name | 1-[3-[4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 45203135 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-[3-[4-[[3-(3,5-dimethylpyrazol-1-yl)propylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
| SMILES | COc1cc(CNCCCn2nc(C)cc2C)ccc1OCC(O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C24H38N4O4/c1-18-13-19(2)28(26-18)10-4-9-25-15-20-5-6-23(24(14-20)31-3)32-17-22(30)16-27-11-7-21(29)8-12-27/h5-6,13-14,21-22,25,29-30H,4,7-12,15-17H2,1-3H3 |
| InChIKey | KXWYFKRRAYVZGF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|