C23H35N3O4S — CID 45211381
1-[2-hydroxy-3-[2-methoxy-4-[[3-(4-methyl-1,3-thiazol-5-yl)propylamino]methyl]phenoxy]propyl]piperidin-4-ol (PubChem CID 45211381) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-[2-hydroxy-3-[2-methoxy-4-[[3-(4-methyl-1,3-thiazol-5-yl)propylamino]methyl]phenoxy]propyl]piperidin-4-ol.
| Compound Name | 1-[2-hydroxy-3-[2-methoxy-4-[[3-(4-methyl-1,3-thiazol-5-yl)propylamino]methyl]phenoxy]propyl]piperidin-4-ol |
|---|---|
| PubChem CID | 45211381 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | 1-[2-hydroxy-3-[2-methoxy-4-[[3-(4-methyl-1,3-thiazol-5-yl)propylamino]methyl]phenoxy]propyl]piperidin-4-ol |
| SMILES | COc1cc(CNCCCc2scnc2C)ccc1OCC(O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C23H35N3O4S/c1-17-23(31-16-25-17)4-3-9-24-13-18-5-6-21(22(12-18)29-2)30-15-20(28)14-26-10-7-19(27)8-11-26/h5-6,12,16,19-20,24,27-28H,3-4,7-11,13-15H2,1-2H3 |
| InChIKey | ZUCLWFWRXJJECV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|