C24H36N4O4 — CID 30851907
1-[(2S)-3-[4-[[2-(4,6-dimethylpyrimidin-2-yl)ethylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol (PubChem CID 30851907) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is 1-[(2S)-3-[4-[[2-(4,6-dimethylpyrimidin-2-yl)ethylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol.
| Compound Name | 1-[(2S)-3-[4-[[2-(4,6-dimethylpyrimidin-2-yl)ethylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 30851907 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 1-[(2S)-3-[4-[[2-(4,6-dimethylpyrimidin-2-yl)ethylamino]methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
| SMILES | COc1cc(CNCCc2nc(C)cc(C)n2)ccc1OC[C@@H](O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C24H36N4O4/c1-17-12-18(2)27-24(26-17)6-9-25-14-19-4-5-22(23(13-19)31-3)32-16-21(30)15-28-10-7-20(29)8-11-28/h4-5,12-13,20-21,25,29-30H,6-11,14-16H2,1-3H3/t21-/m0/s1 |
| InChIKey | UVTCNHXBDBPVHE-NRFANRHFSA-N |
| XLogP | 1.63 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|