C19H29N3O2 — CID 78804390
3-(3,5-dimethylpyrazol-1-yl)-N-[(3-methoxy-4-propoxyphenyl)methyl]propan-1-amine (PubChem CID 78804390) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[(3-methoxy-4-propoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(3-methoxy-4-propoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 78804390 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(3-methoxy-4-propoxyphenyl)methyl]propan-1-amine |
| SMILES | CCCOc1ccc(CNCCCn2nc(C)cc2C)cc1OC |
| InChI | InChI=1S/C19H29N3O2/c1-5-11-24-18-8-7-17(13-19(18)23-4)14-20-9-6-10-22-16(3)12-15(2)21-22/h7-8,12-13,20H,5-6,9-11,14H2,1-4H3 |
| InChIKey | LXWSLBGACNUVHL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|