C18H27N3O3 — CID 78804298
3-(3,5-dimethylpyrazol-1-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine (PubChem CID 78804298) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 78804298 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine |
| SMILES | COc1ccc(CNCCCn2nc(C)cc2C)c(OC)c1OC |
| InChI | InChI=1S/C18H27N3O3/c1-13-11-14(2)21(20-13)10-6-9-19-12-15-7-8-16(22-3)18(24-5)17(15)23-4/h7-8,11,19H,6,9-10,12H2,1-5H3 |
| InChIKey | PEUUSNYHPKHFMM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|