C23H29N3O2 — CID 119110843
N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine (PubChem CID 119110843) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine.
| Compound Name | N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 119110843 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
| SMILES | COc1cc(CNCCCn2nc(C)cc2C)c(-c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H29N3O2/c1-17-13-18(2)26(25-17)12-8-11-24-16-20-14-22(27-3)23(28-4)15-21(20)19-9-6-5-7-10-19/h5-7,9-10,13-15,24H,8,11-12,16H2,1-4H3 |
| InChIKey | YQTDYOPUXUMQQG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|