C21H25N3O2 — CID 119127608
N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-2-(4-methylpyrazol-1-yl)ethanamine (PubChem CID 119127608) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-2-(4-methylpyrazol-1-yl)ethanamine.
| Compound Name | N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-2-(4-methylpyrazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 119127608 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-2-(4-methylpyrazol-1-yl)ethanamine |
| SMILES | COc1cc(CNCCn2cc(C)cn2)c(-c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H25N3O2/c1-16-13-23-24(15-16)10-9-22-14-18-11-20(25-2)21(26-3)12-19(18)17-7-5-4-6-8-17/h4-8,11-13,15,22H,9-10,14H2,1-3H3 |
| InChIKey | VMEWESBPJJAFIX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|