C19H25NO3 — CID 119110830
N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-methoxypropan-1-amine (PubChem CID 119110830) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-methoxypropan-1-amine.
| Compound Name | N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 119110830 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-[(4,5-dimethoxy-2-phenylphenyl)methyl]-3-methoxypropan-1-amine |
| SMILES | COCCCNCc1cc(OC)c(OC)cc1-c1ccccc1 |
| InChI | InChI=1S/C19H25NO3/c1-21-11-7-10-20-14-16-12-18(22-2)19(23-3)13-17(16)15-8-5-4-6-9-15/h4-6,8-9,12-13,20H,7,10-11,14H2,1-3H3 |
| InChIKey | NGCRIKPFTZMSDU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|