C15H19F2N3 — CID 78804287
N-[(2,4-difluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine (PubChem CID 78804287) has the molecular formula C15H19F2N3 and a molecular weight of 279.33 g/mol. Its IUPAC name is N-[(2,4-difluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine.
| Compound Name | N-[(2,4-difluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 78804287 |
| Molecular Formula | C15H19F2N3 |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | N-[(2,4-difluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
| SMILES | Cc1cc(C)n(CCCNCc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C15H19F2N3/c1-11-8-12(2)20(19-11)7-3-6-18-10-13-4-5-14(16)9-15(13)17/h4-5,8-9,18H,3,6-7,10H2,1-2H3 |
| InChIKey | JGBMSKFRXADXIZ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|