C15H19ClFN3 — CID 115574536
N-[(2-chloro-4-fluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine (PubChem CID 115574536) has the molecular formula C15H19ClFN3 and a molecular weight of 295.79 g/mol. Its IUPAC name is N-[(2-chloro-4-fluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine.
| Compound Name | N-[(2-chloro-4-fluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 115574536 |
| Molecular Formula | C15H19ClFN3 |
| Molecular Weight | 295.79 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | N-[(2-chloro-4-fluorophenyl)methyl]-3-(3,5-dimethylpyrazol-1-yl)propan-1-amine |
| SMILES | Cc1cc(C)n(CCCNCc2ccc(F)cc2Cl)n1 |
| InChI | InChI=1S/C15H19ClFN3/c1-11-8-12(2)20(19-11)7-3-6-18-10-13-4-5-14(17)9-15(13)16/h4-5,8-9,18H,3,6-7,10H2,1-2H3 |
| InChIKey | KZTAMYQVBLMMBV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|