C19H28ClFIN5 — CID 111578036
1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide (PubChem CID 111578036) has the molecular formula C19H28ClFIN5 and a molecular weight of 507.82 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111578036 |
| Molecular Formula | C19H28ClFIN5 |
| Molecular Weight | 507.82 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 1-[2-(2-chloro-4-fluorophenyl)ethyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCc1ccc(F)cc1Cl.I |
| InChI | InChI=1S/C19H27ClFN5.HI/c1-4-22-19(23-9-5-11-26-15(3)12-14(2)25-26)24-10-8-16-6-7-17(21)13-18(16)20;/h6-7,12-13H,4-5,8-11H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | WYCNAABNXLRGRW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.82 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|