C21H32FIN6O — CID 111280814
N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111280814) has the molecular formula C21H32FIN6O and a molecular weight of 530.43 g/mol. Its IUPAC name is N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111280814 |
| Molecular Formula | C21H32FIN6O |
| Molecular Weight | 530.43 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-2-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCNC(=O)Cc1cccc(F)c1.I |
| InChI | InChI=1S/C21H31FN6O.HI/c1-4-23-21(25-9-6-12-28-17(3)13-16(2)27-28)26-11-10-24-20(29)15-18-7-5-8-19(22)14-18;/h5,7-8,13-14H,4,6,9-12,15H2,1-3H3,(H,24,29)(H2,23,25,26);1H |
| InChIKey | QLIRGLLFUBXMGU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|