C12H12ClFN2 — CID 102620265
1-[(2-chloro-5-fluorophenyl)methyl]-3,5-dimethylpyrazole (PubChem CID 102620265) has the molecular formula C12H12ClFN2 and a molecular weight of 238.69 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methyl]-3,5-dimethylpyrazole.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methyl]-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 102620265 |
| Molecular Formula | C12H12ClFN2 |
| Molecular Weight | 238.69 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methyl]-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(Cc2cc(F)ccc2Cl)n1 |
| InChI | InChI=1S/C12H12ClFN2/c1-8-5-9(2)16(15-8)7-10-6-11(14)3-4-12(10)13/h3-6H,7H2,1-2H3 |
| InChIKey | KJPLQNZXBVKHIP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |