C11H11BrFN3 — CID 51000352
1-[(2-bromo-5-fluorophenyl)methyl]-5-methylpyrazol-3-amine (PubChem CID 51000352) has the molecular formula C11H11BrFN3 and a molecular weight of 284.13 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]-5-methylpyrazol-3-amine.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]-5-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 51000352 |
| Molecular Formula | C11H11BrFN3 |
| Molecular Weight | 284.13 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]-5-methylpyrazol-3-amine |
| SMILES | Cc1cc(N)nn1Cc1cc(F)ccc1Br |
| InChI | InChI=1S/C11H11BrFN3/c1-7-4-11(14)15-16(7)6-8-5-9(13)2-3-10(8)12/h2-5H,6H2,1H3,(H2,14,15) |
| InChIKey | IGGWLCATHQYLMR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.13 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |